C19H21ClN2O6S2 — CID 55538571
methyl 2-[[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 55538571) has the molecular formula C19H21ClN2O6S2 and a molecular weight of 472.97 g/mol. Its IUPAC name is methyl 2-[[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 55538571 |
| Molecular Formula | C19H21ClN2O6S2 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | methyl 2-[[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)OC)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C19H21ClN2O6S2/c1-22(28-3)30(25,26)15-10-11(8-9-13(15)20)17(23)21-18-16(19(24)27-2)12-6-4-5-7-14(12)29-18/h8-10H,4-7H2,1-3H3,(H,21,23) |
| InChIKey | RCAYOSVYARLFCE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|