About [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate
[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate (PubChem CID 55538994) has the molecular formula C18H21NO4
and a molecular weight of 315.37 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate |
| PubChem CID | 55538994 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate |
| SMILES | COc1ccc(-c2nc(COC(=O)C3CCCCC3)co2)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-21-16-9-7-13(8-10-16)17-19-15(11-22-17)12-23-18(20)14-5-3-2-4-6-14/h7-11,14H,2-6,12H2,1H3 |
| InChIKey | ZXZBGZHKVYYEON-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate?
The IUPAC name of [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate (CID 55538994) is [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate.
What is the SMILES notation for [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate?
The canonical SMILES for [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate is COc1ccc(-c2nc(COC(=O)C3CCCCC3)co2)cc1.
What is the InChIKey of [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate?
The InChIKey is ZXZBGZHKVYYEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO4/c1-21-16-9-7-13(8-10-16)17-19-15(11-22-17)12-23-18(20)14-5-3-2-4-6-14/h7-11,14H,2-6,12H2,1H3.
What are the key properties of [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate?
[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate has a molecular weight of 315.37 g/mol, XLogP of 3.97, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl cyclohexanecarboxylate is sourced from PubChem (CID 55538994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).