C26H23N5OS — CID 55539395
2-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide (PubChem CID 55539395) has the molecular formula C26H23N5OS and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide.
| Compound Name | 2-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55539395 |
| Molecular Formula | C26H23N5OS |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2cccc(C#Cc3ccccn3)c2)nnc1-c1cccc(C)c1 |
| InChI | InChI=1S/C26H23N5OS/c1-3-31-25(21-10-6-8-19(2)16-21)29-30-26(31)33-18-24(32)28-23-12-7-9-20(17-23)13-14-22-11-4-5-15-27-22/h4-12,15-17H,3,18H2,1-2H3,(H,28,32) |
| InChIKey | ZGSLMKWCNTZHAE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|