About (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate
(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate (PubChem CID 55540018) has the molecular formula C15H18N2O4S
and a molecular weight of 322.39 g/mol. Its IUPAC name is (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate.
Molecular Properties
| Compound Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate |
| PubChem CID | 55540018 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate |
| SMILES | CC(C)c1noc(COC(=O)c2cccc(CS(C)=O)c2)n1 |
| InChI | InChI=1S/C15H18N2O4S/c1-10(2)14-16-13(21-17-14)8-20-15(18)12-6-4-5-11(7-12)9-22(3)19/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | CPSHQQLBXAESEG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate?
The IUPAC name of (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate (CID 55540018) is (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate.
What is the SMILES notation for (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate?
The canonical SMILES for (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate is CC(C)c1noc(COC(=O)c2cccc(CS(C)=O)c2)n1.
What is the InChIKey of (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate?
The InChIKey is CPSHQQLBXAESEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4S/c1-10(2)14-16-13(21-17-14)8-20-15(18)12-6-4-5-11(7-12)9-22(3)19/h4-7,10H,8-9H2,1-3H3.
What are the key properties of (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate?
(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate has a molecular weight of 322.39 g/mol, XLogP of 2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-(methylsulfinylmethyl)benzoate is sourced from PubChem (CID 55540018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).