C21H26N4O4S — CID 55540186
3-(diethylsulfamoyl)-N-[4-(prop-2-enylcarbamoylamino)phenyl]benzamide (PubChem CID 55540186) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[4-(prop-2-enylcarbamoylamino)phenyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[4-(prop-2-enylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 55540186 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[4-(prop-2-enylcarbamoylamino)phenyl]benzamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)c2cccc(S(=O)(=O)N(CC)CC)c2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c1-4-14-22-21(27)24-18-12-10-17(11-13-18)23-20(26)16-8-7-9-19(15-16)30(28,29)25(5-2)6-3/h4,7-13,15H,1,5-6,14H2,2-3H3,(H,23,26)(H2,22,24,27) |
| InChIKey | GGTVYNDTXXFVHH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|