C23H21N3O3S2 — CID 55541242
N-(2-cyanoethyl)-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)benzenesulfonamide (PubChem CID 55541242) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)benzenesulfonamide.
| Compound Name | N-(2-cyanoethyl)-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55541242 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-(2-cyanoethyl)-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)benzenesulfonamide |
| SMILES | N#CCCNS(=O)(=O)c1ccc(C(=O)N2CCc3sccc3C2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O3S2/c24-13-4-14-25-31(28,29)19-9-7-18(8-10-19)23(27)26-15-11-21-20(12-16-30-21)22(26)17-5-2-1-3-6-17/h1-3,5-10,12,16,22,25H,4,11,14-15H2 |
| InChIKey | AGBORRSIQWNZQI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|