C20H18N2O4 — CID 55541783
[1-oxo-1-(quinolin-5-ylamino)propan-2-yl] 3-hydroxy-4-methylbenzoate (PubChem CID 55541783) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is [1-oxo-1-(quinolin-5-ylamino)propan-2-yl] 3-hydroxy-4-methylbenzoate.
| Compound Name | [1-oxo-1-(quinolin-5-ylamino)propan-2-yl] 3-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 55541783 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [1-oxo-1-(quinolin-5-ylamino)propan-2-yl] 3-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(C)C(=O)Nc2cccc3ncccc23)cc1O |
| InChI | InChI=1S/C20H18N2O4/c1-12-8-9-14(11-18(12)23)20(25)26-13(2)19(24)22-17-7-3-6-16-15(17)5-4-10-21-16/h3-11,13,23H,1-2H3,(H,22,24) |
| InChIKey | VSLHVEQDLVXASL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |