C26H20N4O5 — CID 55542313
4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide (PubChem CID 55542313) has the molecular formula C26H20N4O5 and a molecular weight of 468.47 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55542313 |
| Molecular Formula | C26H20N4O5 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide |
| SMILES | CC1(c2ccccc2)NC(=O)N(NC(=O)c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)C1=O |
| InChI | InChI=1S/C26H20N4O5/c1-26(18-7-3-2-4-8-18)24(34)30(25(35)27-26)28-21(31)17-13-11-16(12-14-17)15-29-22(32)19-9-5-6-10-20(19)23(29)33/h2-14H,15H2,1H3,(H,27,35)(H,28,31) |
| InChIKey | FYWLHVDGTRILDC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|