C20H26N4O2S2 — CID 55542935
11-hexyl-10-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 55542935) has the molecular formula C20H26N4O2S2 and a molecular weight of 418.59 g/mol. Its IUPAC name is 11-hexyl-10-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 11-hexyl-10-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 55542935 |
| Molecular Formula | C20H26N4O2S2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 11-hexyl-10-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | CCCCCCn1c(SC(C)c2nc(C)no2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C20H26N4O2S2/c1-4-5-6-7-11-24-19(25)16-14-9-8-10-15(14)28-18(16)22-20(24)27-12(2)17-21-13(3)23-26-17/h12H,4-11H2,1-3H3 |
| InChIKey | UXHVRTDWRFYMNJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|