C23H31N3O3 — CID 55543510
tert-butyl N-[1-[2-(N-methylanilino)ethylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 55543510) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(N-methylanilino)ethylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(N-methylanilino)ethylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 55543510 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | tert-butyl N-[1-[2-(N-methylanilino)ethylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CN(CCNC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O3/c1-23(2,3)29-22(28)25-20(17-18-11-7-5-8-12-18)21(27)24-15-16-26(4)19-13-9-6-10-14-19/h5-14,20H,15-17H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | YDGPXKGMZBFARB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |