C21H30N4O4 — CID 55544186
N-[3-[4-[2-oxo-2-(propylamino)ethyl]piperazine-1-carbonyl]phenyl]oxolane-2-carboxamide (PubChem CID 55544186) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[3-[4-[2-oxo-2-(propylamino)ethyl]piperazine-1-carbonyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[4-[2-oxo-2-(propylamino)ethyl]piperazine-1-carbonyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 55544186 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-[3-[4-[2-oxo-2-(propylamino)ethyl]piperazine-1-carbonyl]phenyl]oxolane-2-carboxamide |
| SMILES | CCCNC(=O)CN1CCN(C(=O)c2cccc(NC(=O)C3CCCO3)c2)CC1 |
| InChI | InChI=1S/C21H30N4O4/c1-2-8-22-19(26)15-24-9-11-25(12-10-24)21(28)16-5-3-6-17(14-16)23-20(27)18-7-4-13-29-18/h3,5-6,14,18H,2,4,7-13,15H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | QTQMDUVRIFGHKG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |