About 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate (PubChem CID 55544641) has the molecular formula C13H16N2O4
and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate.
Molecular Properties
| Compound Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate |
| PubChem CID | 55544641 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate |
| SMILES | CC(OC(=O)c1ccco1)c1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C13H16N2O4/c1-8(18-11(16)9-6-5-7-17-9)10-14-12(15-19-10)13(2,3)4/h5-8H,1-4H3 |
| InChIKey | NWJRMQIIZAKIEJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate?
The IUPAC name of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate (CID 55544641) is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate.
What is the SMILES notation for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate?
The canonical SMILES for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate is CC(OC(=O)c1ccco1)c1nc(C(C)(C)C)no1.
What is the InChIKey of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate?
The InChIKey is NWJRMQIIZAKIEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c1-8(18-11(16)9-6-5-7-17-9)10-14-12(15-19-10)13(2,3)4/h5-8H,1-4H3.
What are the key properties of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate?
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate has a molecular weight of 264.28 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl furan-2-carboxylate is sourced from PubChem (CID 55544641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).