About 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one
2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one (PubChem CID 555472) has the molecular formula C23H21NO2
and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one |
| PubChem CID | 555472 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one |
| SMILES | O=c1oc(-c2ccccc2)nc2c1C1(CCCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C23H21NO2/c25-22-19-20(24-21(26-22)16-9-3-1-4-10-16)18-12-6-5-11-17(18)15-23(19)13-7-2-8-14-23/h1,3-6,9-12H,2,7-8,13-15H2 |
| InChIKey | PZLQYODZDXWPSJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one?
The IUPAC name of 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one (CID 555472) is 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one.
What is the SMILES notation for 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one?
The canonical SMILES for 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one is O=c1oc(-c2ccccc2)nc2c1C1(CCCCC1)Cc1ccccc1-2.
What is the InChIKey of 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one?
The InChIKey is PZLQYODZDXWPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO2/c25-22-19-20(24-21(26-22)16-9-3-1-4-10-16)18-12-6-5-11-17(18)15-23(19)13-7-2-8-14-23/h1,3-6,9-12H,2,7-8,13-15H2.
What are the key properties of 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one?
2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one has a molecular weight of 343.43 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylspiro[6H-benzo[h][3,1]benzoxazine-5,1'-cyclohexane]-4-one is sourced from PubChem (CID 555472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).