C20H22N4O6 — CID 55547281
ethyl 4-methyl-2-oxo-6-[[2,4,5-trioxo-3-(1-phenylethyl)imidazolidin-1-yl]methyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 55547281) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is ethyl 4-methyl-2-oxo-6-[[2,4,5-trioxo-3-(1-phenylethyl)imidazolidin-1-yl]methyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-oxo-6-[[2,4,5-trioxo-3-(1-phenylethyl)imidazolidin-1-yl]methyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 55547281 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | ethyl 4-methyl-2-oxo-6-[[2,4,5-trioxo-3-(1-phenylethyl)imidazolidin-1-yl]methyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2C(=O)C(=O)N(C(C)c3ccccc3)C2=O)NC(=O)NC1C |
| InChI | InChI=1S/C20H22N4O6/c1-4-30-18(27)15-11(2)21-19(28)22-14(15)10-23-16(25)17(26)24(20(23)29)12(3)13-8-6-5-7-9-13/h5-9,11-12H,4,10H2,1-3H3,(H2,21,22,28) |
| InChIKey | NFYPEPUOOREWDR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|