C21H27N3O5S — CID 55549044
N-[2-[[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 55549044) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[2-[[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55549044 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[2-[[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(C(=O)NCCNC(=O)c3ccco3)cc2)C1 |
| InChI | InChI=1S/C21H27N3O5S/c1-15-12-16(2)14-24(13-15)30(27,28)18-7-5-17(6-8-18)20(25)22-9-10-23-21(26)19-4-3-11-29-19/h3-8,11,15-16H,9-10,12-14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | XJURTXNNDLAHOE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|