C20H20F3NO3 — CID 55550790
N-methyl-2-(4-propanoylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 55550790) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is N-methyl-2-(4-propanoylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | N-methyl-2-(4-propanoylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55550790 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-methyl-2-(4-propanoylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CCC(=O)c1ccc(OCC(=O)N(C)Cc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO3/c1-3-18(25)14-8-10-16(11-9-14)27-13-19(26)24(2)12-15-6-4-5-7-17(15)20(21,22)23/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | GJKNXGJRNKKIKV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |