About (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate
(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 55551565) has the molecular formula C16H10BrFN2O3S
and a molecular weight of 409.24 g/mol. Its IUPAC name is (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| PubChem CID | 55551565 |
| Molecular Formula | C16H10BrFN2O3S |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)OCc1noc(-c2ccsc2)n1 |
| InChI | InChI=1S/C16H10BrFN2O3S/c17-12-2-3-13(18)10(7-12)1-4-15(21)22-8-14-19-16(23-20-14)11-5-6-24-9-11/h1-7,9H,8H2/b4-1+ |
| InChIKey | DKAQHBKZWYAETL-DAFODLJHSA-N |
| XLogP | 4.46 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate?
The IUPAC name of (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (CID 55551565) is (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
What is the SMILES notation for (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate?
The canonical SMILES for (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate is O=C(/C=C/c1cc(Br)ccc1F)OCc1noc(-c2ccsc2)n1.
What is the InChIKey of (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate?
The InChIKey is DKAQHBKZWYAETL-DAFODLJHSA-N. The full InChI is InChI=1S/C16H10BrFN2O3S/c17-12-2-3-13(18)10(7-12)1-4-15(21)22-8-14-19-16(23-20-14)11-5-6-24-9-11/h1-7,9H,8H2/b4-1+.
What are the key properties of (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate?
(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate has a molecular weight of 409.24 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate is sourced from PubChem (CID 55551565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).