About 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate (PubChem CID 55553350) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate.
Molecular Properties
| Compound Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate |
| PubChem CID | 55553350 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate |
| SMILES | CC(OC(=O)Cc1ccccc1)c1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C16H20N2O3/c1-11(14-17-15(18-21-14)16(2,3)4)20-13(19)10-12-8-6-5-7-9-12/h5-9,11H,10H2,1-4H3 |
| InChIKey | VXOVHWUSBKYZTO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate?
The IUPAC name of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate (CID 55553350) is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate.
What is the SMILES notation for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate?
The canonical SMILES for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate is CC(OC(=O)Cc1ccccc1)c1nc(C(C)(C)C)no1.
What is the InChIKey of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate?
The InChIKey is VXOVHWUSBKYZTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-11(14-17-15(18-21-14)16(2,3)4)20-13(19)10-12-8-6-5-7-9-12/h5-9,11H,10H2,1-4H3.
What are the key properties of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate?
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate has a molecular weight of 288.35 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-phenylacetate is sourced from PubChem (CID 55553350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).