C20H22O5S2 — CID 555540
2-[2,2-bis(benzenesulfonyl)ethyl]cyclohexan-1-one (PubChem CID 555540) has the molecular formula C20H22O5S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[2,2-bis(benzenesulfonyl)ethyl]cyclohexan-1-one.
| Compound Name | 2-[2,2-bis(benzenesulfonyl)ethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 555540 |
| Molecular Formula | C20H22O5S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-[2,2-bis(benzenesulfonyl)ethyl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22O5S2/c21-19-14-8-7-9-16(19)15-20(26(22,23)17-10-3-1-4-11-17)27(24,25)18-12-5-2-6-13-18/h1-6,10-13,16,20H,7-9,14-15H2 |
| InChIKey | RKNFZPNVRLPFTC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |