C21H14F2N2O3 — CID 55554421
N',2-bis(4-fluorobenzoyl)benzohydrazide (PubChem CID 55554421) has the molecular formula C21H14F2N2O3 and a molecular weight of 380.35 g/mol. Its IUPAC name is N',2-bis(4-fluorobenzoyl)benzohydrazide.
| Compound Name | N',2-bis(4-fluorobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 55554421 |
| Molecular Formula | C21H14F2N2O3 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N',2-bis(4-fluorobenzoyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1C(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H14F2N2O3/c22-15-9-5-13(6-10-15)19(26)17-3-1-2-4-18(17)21(28)25-24-20(27)14-7-11-16(23)12-8-14/h1-12H,(H,24,27)(H,25,28) |
| InChIKey | UGWJBSCMLQLEOO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|