C24H33N7OS — CID 55554817
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide (PubChem CID 55554817) has the molecular formula C24H33N7OS and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 55554817 |
| Molecular Formula | C24H33N7OS |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
| SMILES | CSc1nnc(CCCNC(=O)c2cc(C)nc3c2nc2n3CCCCC2)n1C1CCCC1 |
| InChI | InChI=1S/C24H33N7OS/c1-16-15-18(21-22(26-16)30-14-7-3-4-11-19(30)27-21)23(32)25-13-8-12-20-28-29-24(33-2)31(20)17-9-5-6-10-17/h15,17H,3-14H2,1-2H3,(H,25,32) |
| InChIKey | CQEWSDVHOOKITE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|