C22H23F2N5O2 — CID 55554901
N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide (PubChem CID 55554901) has the molecular formula C22H23F2N5O2 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide.
| Compound Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 55554901 |
| Molecular Formula | C22H23F2N5O2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
| SMILES | CNC(=O)C(NC(=O)c1cc(C)nc2c1nc1n2CCCCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H23F2N5O2/c1-12-10-14(19-20(26-12)29-9-5-3-4-6-17(29)27-19)21(30)28-18(22(31)25-2)13-7-8-15(23)16(24)11-13/h7-8,10-11,18H,3-6,9H2,1-2H3,(H,25,31)(H,28,30) |
| InChIKey | UAZLTENFZOJSOM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |