C15H22F3N3O4 — CID 55555565
methyl 6-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butanoyl]amino]hexanoate (PubChem CID 55555565) has the molecular formula C15H22F3N3O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is methyl 6-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butanoyl]amino]hexanoate.
| Compound Name | methyl 6-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 55555565 |
| Molecular Formula | C15H22F3N3O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | methyl 6-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butanoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)CC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C15H22F3N3O4/c1-21-9-8-20-13(21)14(24,15(16,17)18)10-11(22)19-7-5-3-4-6-12(23)25-2/h8-9,24H,3-7,10H2,1-2H3,(H,19,22) |
| InChIKey | MMVHMJAJIFQWTO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|