C16H10N4O3 — CID 555556
5,6-dioxido-4,7-diphenyl-[1,2,5]oxadiazolo[3,4-d]pyridazine-5,6-diium (PubChem CID 555556) has the molecular formula C16H10N4O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 5,6-dioxido-4,7-diphenyl-[1,2,5]oxadiazolo[3,4-d]pyridazine-5,6-diium.
| Compound Name | 5,6-dioxido-4,7-diphenyl-[1,2,5]oxadiazolo[3,4-d]pyridazine-5,6-diium |
|---|---|
| PubChem CID | 555556 |
| Molecular Formula | C16H10N4O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5,6-dioxido-4,7-diphenyl-[1,2,5]oxadiazolo[3,4-d]pyridazine-5,6-diium |
| SMILES | [O-][n+]1c(-c2ccccc2)c2nonc2c(-c2ccccc2)[n+]1[O-] |
| InChI | InChI=1S/C16H10N4O3/c21-19-15(11-7-3-1-4-8-11)13-14(18-23-17-13)16(20(19)22)12-9-5-2-6-10-12/h1-10H |
| InChIKey | ANMMMCOFQOHMPR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 92.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|