C18H16ClF2NO2 — CID 55555870
2-(3-chloro-4-fluorophenoxy)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 55555870) has the molecular formula C18H16ClF2NO2 and a molecular weight of 351.78 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenoxy)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(3-chloro-4-fluorophenoxy)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 55555870 |
| Molecular Formula | C18H16ClF2NO2 |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-(3-chloro-4-fluorophenoxy)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(COc1ccc(F)c(Cl)c1)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C18H16ClF2NO2/c19-16-9-15(7-8-17(16)21)24-11-18(23)22(14-5-6-14)10-12-1-3-13(20)4-2-12/h1-4,7-9,14H,5-6,10-11H2 |
| InChIKey | UAERNEPJUDVOAS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |