C21H22Cl2N2O5 — CID 55556525
(3,5-dichlorophenyl)-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]methanone (PubChem CID 55556525) has the molecular formula C21H22Cl2N2O5 and a molecular weight of 453.32 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | (3,5-dichlorophenyl)-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55556525 |
| Molecular Formula | C21H22Cl2N2O5 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (3,5-dichlorophenyl)-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)c3cc(Cl)cc(Cl)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H22Cl2N2O5/c1-28-17-10-14(11-18(29-2)19(17)30-3)21(27)25-6-4-24(5-7-25)20(26)13-8-15(22)12-16(23)9-13/h8-12H,4-7H2,1-3H3 |
| InChIKey | OHIDBJOYPGDXPD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |