C14H19N5O2S2 — CID 55556911
N-[5-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N-cyclopropylacetamide (PubChem CID 55556911) has the molecular formula C14H19N5O2S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[5-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N-cyclopropylacetamide.
| Compound Name | N-[5-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 55556911 |
| Molecular Formula | C14H19N5O2S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[5-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N-cyclopropylacetamide |
| SMILES | CC(=O)N(c1nnc(SCc2nc(C(C)(C)C)no2)s1)C1CC1 |
| InChI | InChI=1S/C14H19N5O2S2/c1-8(20)19(9-5-6-9)12-16-17-13(23-12)22-7-10-15-11(18-21-10)14(2,3)4/h9H,5-7H2,1-4H3 |
| InChIKey | HTRYNDVMRSROKO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|