About 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one
6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one (PubChem CID 55557861) has the molecular formula C17H18Cl2N4O3
and a molecular weight of 397.26 g/mol. Its IUPAC name is 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one |
| PubChem CID | 55557861 |
| Molecular Formula | C17H18Cl2N4O3 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one |
| SMILES | CN1N=C(C(=O)N2CCN(C(=O)c3cc(Cl)cc(Cl)c3)CC2)CCC1=O |
| InChI | InChI=1S/C17H18Cl2N4O3/c1-21-15(24)3-2-14(20-21)17(26)23-6-4-22(5-7-23)16(25)11-8-12(18)10-13(19)9-11/h8-10H,2-7H2,1H3 |
| InChIKey | YAJRKTZNCHIVCO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
The IUPAC name of 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one (CID 55557861) is 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
The canonical SMILES for 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one is CN1N=C(C(=O)N2CCN(C(=O)c3cc(Cl)cc(Cl)c3)CC2)CCC1=O.
What is the InChIKey of 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
The InChIKey is YAJRKTZNCHIVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N4O3/c1-21-15(24)3-2-14(20-21)17(26)23-6-4-22(5-7-23)16(25)11-8-12(18)10-13(19)9-11/h8-10H,2-7H2,1H3.
What are the key properties of 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one has a molecular weight of 397.26 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 55557861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).