C22H33N3O3 — CID 55558062
4-(4-butoxybenzoyl)-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 55558062) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 4-(4-butoxybenzoyl)-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 4-(4-butoxybenzoyl)-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 55558062 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 4-(4-butoxybenzoyl)-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)N2CCN(C(=O)NC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O3/c1-2-3-17-28-20-11-9-18(10-12-20)21(26)24-13-15-25(16-14-24)22(27)23-19-7-5-4-6-8-19/h9-12,19H,2-8,13-17H2,1H3,(H,23,27) |
| InChIKey | IENBBPZMGHCQHX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|