C13H15N3O4S2 — CID 55560053
3-N-(2-pyridin-3-ylethyl)benzene-1,3-disulfonamide (PubChem CID 55560053) has the molecular formula C13H15N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-N-(2-pyridin-3-ylethyl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-(2-pyridin-3-ylethyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 55560053 |
| Molecular Formula | C13H15N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3-N-(2-pyridin-3-ylethyl)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NCCc2cccnc2)c1 |
| InChI | InChI=1S/C13H15N3O4S2/c14-21(17,18)12-4-1-5-13(9-12)22(19,20)16-8-6-11-3-2-7-15-10-11/h1-5,7,9-10,16H,6,8H2,(H2,14,17,18) |
| InChIKey | PEAIZIORZSJKBS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |