C24H24N2O5 — CID 55560326
methyl 1-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]cyclopentane-1-carboxylate (PubChem CID 55560326) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl 1-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 55560326 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | methyl 1-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)ccc2C)C3=O)CCCC1 |
| InChI | InChI=1S/C24H24N2O5/c1-14-6-7-15(2)19(12-14)26-21(28)17-9-8-16(13-18(17)22(26)29)20(27)25-24(23(30)31-3)10-4-5-11-24/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,25,27) |
| InChIKey | MHEXTGNUDFYBCX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|