C20H16FN5O4 — CID 55560989
2-(4-fluorophenyl)-5-N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 55560989) has the molecular formula C20H16FN5O4 and a molecular weight of 409.38 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 55560989 |
| Molecular Formula | C20H16FN5O4 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-(4-fluorophenyl)-5-N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)C3=NN(c4ccc(F)cc4)C(C(N)=O)C3)cc2C1=O |
| InChI | InChI=1S/C20H16FN5O4/c1-25-19(29)13-7-4-11(8-14(13)20(25)30)23-18(28)15-9-16(17(22)27)26(24-15)12-5-2-10(21)3-6-12/h2-8,16H,9H2,1H3,(H2,22,27)(H,23,28) |
| InChIKey | JASIRUPQAUSUCK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|