About cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate
cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 55561698) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
Molecular Properties
| Compound Name | cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| PubChem CID | 55561698 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | NC(=O)C1CC(C(=O)OC2CCCCC2)=NN1c1ccccc1 |
| InChI | InChI=1S/C17H21N3O3/c18-16(21)15-11-14(17(22)23-13-9-5-2-6-10-13)19-20(15)12-7-3-1-4-8-12/h1,3-4,7-8,13,15H,2,5-6,9-11H2,(H2,18,21) |
| InChIKey | PGUZVKLCELNAOP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
The IUPAC name of cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate (CID 55561698) is cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
What is the SMILES notation for cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
The canonical SMILES for cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate is NC(=O)C1CC(C(=O)OC2CCCCC2)=NN1c1ccccc1.
What is the InChIKey of cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
The InChIKey is PGUZVKLCELNAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c18-16(21)15-11-14(17(22)23-13-9-5-2-6-10-13)19-20(15)12-7-3-1-4-8-12/h1,3-4,7-8,13,15H,2,5-6,9-11H2,(H2,18,21).
What are the key properties of cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate has a molecular weight of 315.37 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 3-carbamoyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate is sourced from PubChem (CID 55561698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).