About [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate
[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate (PubChem CID 55562159) has the molecular formula C19H21N3O3S
and a molecular weight of 371.46 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate.
Molecular Properties
| Compound Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate |
| PubChem CID | 55562159 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate |
| SMILES | COc1ccccc1-c1nc(COC(=O)CCn2nc(C)cc2C)cs1 |
| InChI | InChI=1S/C19H21N3O3S/c1-13-10-14(2)22(21-13)9-8-18(23)25-11-15-12-26-19(20-15)16-6-4-5-7-17(16)24-3/h4-7,10,12H,8-9,11H2,1-3H3 |
| InChIKey | OQWHCYHBEPKANW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate?
The IUPAC name of [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate (CID 55562159) is [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate.
What is the SMILES notation for [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate?
The canonical SMILES for [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate is COc1ccccc1-c1nc(COC(=O)CCn2nc(C)cc2C)cs1.
What is the InChIKey of [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate?
The InChIKey is OQWHCYHBEPKANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3S/c1-13-10-14(2)22(21-13)9-8-18(23)25-11-15-12-26-19(20-15)16-6-4-5-7-17(16)24-3/h4-7,10,12H,8-9,11H2,1-3H3.
What are the key properties of [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate?
[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate has a molecular weight of 371.46 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(3,5-dimethylpyrazol-1-yl)propanoate is sourced from PubChem (CID 55562159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).