C21H25ClN4O3 — CID 55564029
5-[(E)-3-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-3-oxoprop-1-enyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 55564029) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 5-[(E)-3-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-3-oxoprop-1-enyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[(E)-3-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-3-oxoprop-1-enyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55564029 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5-[(E)-3-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-3-oxoprop-1-enyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CC(c1ccccc1Cl)N1CCN(C(=O)/C=C/c2cn(C)c(=O)n(C)c2=O)CC1 |
| InChI | InChI=1S/C21H25ClN4O3/c1-15(17-6-4-5-7-18(17)22)25-10-12-26(13-11-25)19(27)9-8-16-14-23(2)21(29)24(3)20(16)28/h4-9,14-15H,10-13H2,1-3H3/b9-8+ |
| InChIKey | LUFYRFRAIBKCQG-CMDGGOBGSA-N |
| XLogP | 1.66 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|