C23H27ClN2O2 — CID 55564526
1-[4-[3-(2-chlorophenyl)propanoyl]piperazin-1-yl]-2-methyl-2-phenylpropan-1-one (PubChem CID 55564526) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is 1-[4-[3-(2-chlorophenyl)propanoyl]piperazin-1-yl]-2-methyl-2-phenylpropan-1-one.
| Compound Name | 1-[4-[3-(2-chlorophenyl)propanoyl]piperazin-1-yl]-2-methyl-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 55564526 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-[4-[3-(2-chlorophenyl)propanoyl]piperazin-1-yl]-2-methyl-2-phenylpropan-1-one |
| SMILES | CC(C)(C(=O)N1CCN(C(=O)CCc2ccccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H27ClN2O2/c1-23(2,19-9-4-3-5-10-19)22(28)26-16-14-25(15-17-26)21(27)13-12-18-8-6-7-11-20(18)24/h3-11H,12-17H2,1-2H3 |
| InChIKey | GDTMBTOCSWPKQO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |