C19H17FN6O3S — CID 55567910
N-[3-[3-[2-[2-(4-fluorobenzoyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]phenyl]acetamide (PubChem CID 55567910) has the molecular formula C19H17FN6O3S and a molecular weight of 428.45 g/mol. Its IUPAC name is N-[3-[3-[2-[2-(4-fluorobenzoyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]phenyl]acetamide.
| Compound Name | N-[3-[3-[2-[2-(4-fluorobenzoyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 55567910 |
| Molecular Formula | C19H17FN6O3S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[3-[3-[2-[2-(4-fluorobenzoyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-n2cnnc2SCC(=O)NNC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H17FN6O3S/c1-12(27)22-15-3-2-4-16(9-15)26-11-21-25-19(26)30-10-17(28)23-24-18(29)13-5-7-14(20)8-6-13/h2-9,11H,10H2,1H3,(H,22,27)(H,23,28)(H,24,29) |
| InChIKey | KBHXLHCDQQEJLT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|