About N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide
N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 55568578) has the molecular formula C14H10F3N5O2S
and a molecular weight of 369.33 g/mol. Its IUPAC name is N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 55568578 |
| Molecular Formula | C14H10F3N5O2S |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-n2cncn2)nc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H10F3N5O2S/c15-14(16,17)11-3-1-2-4-12(11)25(23,24)21-10-5-6-13(19-7-10)22-9-18-8-20-22/h1-9,21H |
| InChIKey | KXMIATXZWPUMGN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide (CID 55568578) is N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide is O=S(=O)(Nc1ccc(-n2cncn2)nc1)c1ccccc1C(F)(F)F.
What is the InChIKey of N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide?
The InChIKey is KXMIATXZWPUMGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N5O2S/c15-14(16,17)11-3-1-2-4-12(11)25(23,24)21-10-5-6-13(19-7-10)22-9-18-8-20-22/h1-9,21H.
What are the key properties of N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide?
N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide has a molecular weight of 369.33 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-2-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 55568578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).