C22H23NO5 — CID 55569612
[1-(3,4-dihydro-2H-chromen-4-ylamino)-1-oxopropan-2-yl] 4-prop-2-enoxybenzoate (PubChem CID 55569612) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-chromen-4-ylamino)-1-oxopropan-2-yl] 4-prop-2-enoxybenzoate.
| Compound Name | [1-(3,4-dihydro-2H-chromen-4-ylamino)-1-oxopropan-2-yl] 4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 55569612 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [1-(3,4-dihydro-2H-chromen-4-ylamino)-1-oxopropan-2-yl] 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OC(C)C(=O)NC2CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-3-13-26-17-10-8-16(9-11-17)22(25)28-15(2)21(24)23-19-12-14-27-20-7-5-4-6-18(19)20/h3-11,15,19H,1,12-14H2,2H3,(H,23,24) |
| InChIKey | UPIBKBZJOCOKPJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|