About N,1-diphenylethanimine
N,1-diphenylethanimine (PubChem CID 555698) has the molecular formula C14H13N
and a molecular weight of 195.27 g/mol. Its IUPAC name is N,1-diphenylethanimine.
Molecular Properties
| Compound Name | N,1-diphenylethanimine |
| PubChem CID | 555698 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N,1-diphenylethanimine |
| SMILES | C/C(=N\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13N/c1-12(13-8-4-2-5-9-13)15-14-10-6-3-7-11-14/h2-11H,1H3/b15-12+ |
| InChIKey | CBXWICRJSHEQJT-NTCAYCPXSA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,1-diphenylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-diphenylethanimine?
The IUPAC name of N,1-diphenylethanimine (CID 555698) is N,1-diphenylethanimine.
What is the SMILES notation for N,1-diphenylethanimine?
The canonical SMILES for N,1-diphenylethanimine is C/C(=N\c1ccccc1)c1ccccc1.
What is the InChIKey of N,1-diphenylethanimine?
The InChIKey is CBXWICRJSHEQJT-NTCAYCPXSA-N. The full InChI is InChI=1S/C14H13N/c1-12(13-8-4-2-5-9-13)15-14-10-6-3-7-11-14/h2-11H,1H3/b15-12+.
What are the key properties of N,1-diphenylethanimine?
N,1-diphenylethanimine has a molecular weight of 195.27 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-diphenylethanimine is sourced from PubChem (CID 555698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).