C24H34N4O3 — CID 55570754
2-[4-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]piperazin-1-yl]-N-butan-2-ylacetamide (PubChem CID 55570754) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-[4-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]piperazin-1-yl]-N-butan-2-ylacetamide.
| Compound Name | 2-[4-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]piperazin-1-yl]-N-butan-2-ylacetamide |
|---|---|
| PubChem CID | 55570754 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 2-[4-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]piperazin-1-yl]-N-butan-2-ylacetamide |
| SMILES | CCC(C)NC(=O)CN1CCN(CC(=O)N(Cc2ccccc2)Cc2ccco2)CC1 |
| InChI | InChI=1S/C24H34N4O3/c1-3-20(2)25-23(29)18-26-11-13-27(14-12-26)19-24(30)28(17-22-10-7-15-31-22)16-21-8-5-4-6-9-21/h4-10,15,20H,3,11-14,16-19H2,1-2H3,(H,25,29) |
| InChIKey | YNWZLJNZGPDJOV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |