C14H22N2O3S — CID 55571263
N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)azepane-1-sulfonamide (PubChem CID 55571263) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)azepane-1-sulfonamide.
| Compound Name | N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)azepane-1-sulfonamide |
|---|---|
| PubChem CID | 55571263 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)azepane-1-sulfonamide |
| SMILES | O=S(=O)(NC1CCCc2occc21)N1CCCCCC1 |
| InChI | InChI=1S/C14H22N2O3S/c17-20(18,16-9-3-1-2-4-10-16)15-13-6-5-7-14-12(13)8-11-19-14/h8,11,13,15H,1-7,9-10H2 |
| InChIKey | PNOKIHRNQNTYOO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |