C26H32N4O — CID 55572493
2-[4-(4-ethylpiperazin-1-yl)-2-methylanilino]-N-naphthalen-1-ylpropanamide (PubChem CID 55572493) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[4-(4-ethylpiperazin-1-yl)-2-methylanilino]-N-naphthalen-1-ylpropanamide.
| Compound Name | 2-[4-(4-ethylpiperazin-1-yl)-2-methylanilino]-N-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 55572493 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 2-[4-(4-ethylpiperazin-1-yl)-2-methylanilino]-N-naphthalen-1-ylpropanamide |
| SMILES | CCN1CCN(c2ccc(NC(C)C(=O)Nc3cccc4ccccc34)c(C)c2)CC1 |
| InChI | InChI=1S/C26H32N4O/c1-4-29-14-16-30(17-15-29)22-12-13-24(19(2)18-22)27-20(3)26(31)28-25-11-7-9-21-8-5-6-10-23(21)25/h5-13,18,20,27H,4,14-17H2,1-3H3,(H,28,31) |
| InChIKey | WQKFIHHQRBHOET-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|