C20H24BrNO3 — CID 55574875
3-(3-bromo-4-methoxyphenyl)-N-[1-(4-methoxyphenyl)ethyl]-N-methylpropanamide (PubChem CID 55574875) has the molecular formula C20H24BrNO3 and a molecular weight of 406.32 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-N-[1-(4-methoxyphenyl)ethyl]-N-methylpropanamide.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-N-[1-(4-methoxyphenyl)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 55574875 |
| Molecular Formula | C20H24BrNO3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-N-[1-(4-methoxyphenyl)ethyl]-N-methylpropanamide |
| SMILES | COc1ccc(C(C)N(C)C(=O)CCc2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C20H24BrNO3/c1-14(16-7-9-17(24-3)10-8-16)22(2)20(23)12-6-15-5-11-19(25-4)18(21)13-15/h5,7-11,13-14H,6,12H2,1-4H3 |
| InChIKey | DUKFFUDJDVIOHC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |