C19H17F2N3O4 — CID 55575508
N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(2-methyl-4-oxoquinazolin-3-yl)acetamide (PubChem CID 55575508) has the molecular formula C19H17F2N3O4 and a molecular weight of 389.36 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(2-methyl-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(2-methyl-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55575508 |
| Molecular Formula | C19H17F2N3O4 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(2-methyl-4-oxoquinazolin-3-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c(C)nc3ccccc3c2=O)cc1OC(F)F |
| InChI | InChI=1S/C19H17F2N3O4/c1-11-22-14-6-4-3-5-13(14)18(26)24(11)10-17(25)23-12-7-8-15(27-2)16(9-12)28-19(20)21/h3-9,19H,10H2,1-2H3,(H,23,25) |
| InChIKey | AEGUCBRQCGOPCI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |