C18H27NO2 — CID 55575535
1-(azocan-1-yl)-3-(2,4-dimethylphenoxy)propan-1-one (PubChem CID 55575535) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(azocan-1-yl)-3-(2,4-dimethylphenoxy)propan-1-one.
| Compound Name | 1-(azocan-1-yl)-3-(2,4-dimethylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 55575535 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-(azocan-1-yl)-3-(2,4-dimethylphenoxy)propan-1-one |
| SMILES | Cc1ccc(OCCC(=O)N2CCCCCCC2)c(C)c1 |
| InChI | InChI=1S/C18H27NO2/c1-15-8-9-17(16(2)14-15)21-13-10-18(20)19-11-6-4-3-5-7-12-19/h8-9,14H,3-7,10-13H2,1-2H3 |
| InChIKey | PFCNBPXYXNRKQD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |