C18H16N4O2S2 — CID 55578168
7-methyl-3-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 55578168) has the molecular formula C18H16N4O2S2 and a molecular weight of 384.49 g/mol. Its IUPAC name is 7-methyl-3-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-methyl-3-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55578168 |
| Molecular Formula | C18H16N4O2S2 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 7-methyl-3-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1CCc2c(sc3ncn(Cc4noc(-c5ccsc5)n4)c(=O)c23)C1 |
| InChI | InChI=1S/C18H16N4O2S2/c1-10-2-3-12-13(6-10)26-17-15(12)18(23)22(9-19-17)7-14-20-16(24-21-14)11-4-5-25-8-11/h4-5,8-10H,2-3,6-7H2,1H3 |
| InChIKey | VZTLXURDBATTGA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |