C20H22N2O3S — CID 55579307
3-(1,3-benzothiazol-2-yl)-N-[1-(2,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 55579307) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[1-(2,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[1-(2,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 55579307 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[1-(2,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(C(C)NC(=O)CCc2nc3ccccc3s2)c(OC)c1 |
| InChI | InChI=1S/C20H22N2O3S/c1-13(15-9-8-14(24-2)12-17(15)25-3)21-19(23)10-11-20-22-16-6-4-5-7-18(16)26-20/h4-9,12-13H,10-11H2,1-3H3,(H,21,23) |
| InChIKey | DZFQNFPUWBBIQI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |