C19H21BrClNO4 — CID 55580167
2-(2-bromo-4-chlorophenoxy)-N-[1-(2,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 55580167) has the molecular formula C19H21BrClNO4 and a molecular weight of 442.74 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-[1-(2,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-[1-(2,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 55580167 |
| Molecular Formula | C19H21BrClNO4 |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-[1-(2,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(C(C)NC(=O)C(C)Oc2ccc(Cl)cc2Br)c(OC)c1 |
| InChI | InChI=1S/C19H21BrClNO4/c1-11(15-7-6-14(24-3)10-18(15)25-4)22-19(23)12(2)26-17-8-5-13(21)9-16(17)20/h5-12H,1-4H3,(H,22,23) |
| InChIKey | FYULOIITXMJGJE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |