C12H10N4O2 — CID 555805
3-amino-2-phenyl-7H-pyrazolo[4,3-c]pyridine-4,6-dione (PubChem CID 555805) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-amino-2-phenyl-7H-pyrazolo[4,3-c]pyridine-4,6-dione.
| Compound Name | 3-amino-2-phenyl-7H-pyrazolo[4,3-c]pyridine-4,6-dione |
|---|---|
| PubChem CID | 555805 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-amino-2-phenyl-7H-pyrazolo[4,3-c]pyridine-4,6-dione |
| SMILES | Nc1c2c(nn1-c1ccccc1)CC(=O)NC2=O |
| InChI | InChI=1S/C12H10N4O2/c13-11-10-8(6-9(17)14-12(10)18)15-16(11)7-4-2-1-3-5-7/h1-5H,6,13H2,(H,14,17,18) |
| InChIKey | VANFLNQFMGDRQY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|